C10H16N6O — CID 106386535
N-(4-azidobutyl)-1,5-dimethylpyrazole-4-carboxamide (PubChem CID 106386535) has the molecular formula C10H16N6O and a molecular weight of 236.28 g/mol. Its IUPAC name is N-(4-azidobutyl)-1,5-dimethylpyrazole-4-carboxamide.
| Compound Name | N-(4-azidobutyl)-1,5-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 106386535 |
| Molecular Formula | C10H16N6O |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | N-(4-azidobutyl)-1,5-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCCCN=[N+]=[N-])cnn1C |
| InChI | InChI=1S/C10H16N6O/c1-8-9(7-14-16(8)2)10(17)12-5-3-4-6-13-15-11/h7H,3-6H2,1-2H3,(H,12,17) |
| InChIKey | HBCFJPNOWZAOBT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 95.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|