C11H19N3O3 — CID 113364754
N-[3-(2-hydroxyethoxy)propyl]-1,5-dimethylpyrazole-4-carboxamide (PubChem CID 113364754) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is N-[3-(2-hydroxyethoxy)propyl]-1,5-dimethylpyrazole-4-carboxamide.
| Compound Name | N-[3-(2-hydroxyethoxy)propyl]-1,5-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 113364754 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | N-[3-(2-hydroxyethoxy)propyl]-1,5-dimethylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCCOCCO)cnn1C |
| InChI | InChI=1S/C11H19N3O3/c1-9-10(8-13-14(9)2)11(16)12-4-3-6-17-7-5-15/h8,15H,3-7H2,1-2H3,(H,12,16) |
| InChIKey | PYEOJGZARNVFSF-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|