C10H13N3S — CID 102803051
(1,3-dimethylpyrazol-4-yl)-thiophen-2-ylmethanamine (PubChem CID 102803051) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is (1,3-dimethylpyrazol-4-yl)-thiophen-2-ylmethanamine.
| Compound Name | (1,3-dimethylpyrazol-4-yl)-thiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 102803051 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | (1,3-dimethylpyrazol-4-yl)-thiophen-2-ylmethanamine |
| SMILES | Cc1nn(C)cc1C(N)c1cccs1 |
| InChI | InChI=1S/C10H13N3S/c1-7-8(6-13(2)12-7)10(11)9-4-3-5-14-9/h3-6,10H,11H2,1-2H3 |
| InChIKey | DTHYKWVAMBBDCT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |