C10H19N3 — CID 102803171
1-(1,3-dimethylpyrazol-4-yl)pentan-1-amine (PubChem CID 102803171) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-(1,3-dimethylpyrazol-4-yl)pentan-1-amine.
| Compound Name | 1-(1,3-dimethylpyrazol-4-yl)pentan-1-amine |
|---|---|
| PubChem CID | 102803171 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 1-(1,3-dimethylpyrazol-4-yl)pentan-1-amine |
| SMILES | CCCCC(N)c1cn(C)nc1C |
| InChI | InChI=1S/C10H19N3/c1-4-5-6-10(11)9-7-13(3)12-8(9)2/h7,10H,4-6,11H2,1-3H3 |
| InChIKey | WBHXGNGYVCWUBI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |