C13H15Cl2N3 — CID 102803231
2-(2,4-dichlorophenyl)-1-(1,3-dimethylpyrazol-4-yl)ethanamine (PubChem CID 102803231) has the molecular formula C13H15Cl2N3 and a molecular weight of 284.19 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-(1,3-dimethylpyrazol-4-yl)ethanamine.
| Compound Name | 2-(2,4-dichlorophenyl)-1-(1,3-dimethylpyrazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 102803231 |
| Molecular Formula | C13H15Cl2N3 |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-(1,3-dimethylpyrazol-4-yl)ethanamine |
| SMILES | Cc1nn(C)cc1C(N)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H15Cl2N3/c1-8-11(7-18(2)17-8)13(16)5-9-3-4-10(14)6-12(9)15/h3-4,6-7,13H,5,16H2,1-2H3 |
| InChIKey | RBPKOMHHBWKPHM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |