C14H16N4O2S — CID 102805471
4-[2-[(1,3-dimethylpyrazol-4-yl)amino]ethylsulfonyl]benzonitrile (PubChem CID 102805471) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is 4-[2-[(1,3-dimethylpyrazol-4-yl)amino]ethylsulfonyl]benzonitrile.
| Compound Name | 4-[2-[(1,3-dimethylpyrazol-4-yl)amino]ethylsulfonyl]benzonitrile |
|---|---|
| PubChem CID | 102805471 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 4-[2-[(1,3-dimethylpyrazol-4-yl)amino]ethylsulfonyl]benzonitrile |
| SMILES | Cc1nn(C)cc1NCCS(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H16N4O2S/c1-11-14(10-18(2)17-11)16-7-8-21(19,20)13-5-3-12(9-15)4-6-13/h3-6,10,16H,7-8H2,1-2H3 |
| InChIKey | YDQFJRYGVCIKRL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |