C16H24N2O2S — CID 83142179
4-[2-(2,3,3-trimethylbutylamino)ethylsulfonyl]benzonitrile (PubChem CID 83142179) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is 4-[2-(2,3,3-trimethylbutylamino)ethylsulfonyl]benzonitrile.
| Compound Name | 4-[2-(2,3,3-trimethylbutylamino)ethylsulfonyl]benzonitrile |
|---|---|
| PubChem CID | 83142179 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 4-[2-(2,3,3-trimethylbutylamino)ethylsulfonyl]benzonitrile |
| SMILES | CC(CNCCS(=O)(=O)c1ccc(C#N)cc1)C(C)(C)C |
| InChI | InChI=1S/C16H24N2O2S/c1-13(16(2,3)4)12-18-9-10-21(19,20)15-7-5-14(11-17)6-8-15/h5-8,13,18H,9-10,12H2,1-4H3 |
| InChIKey | XYUPXQQVDNFDCY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|