C14H19N3O3S — CID 106275947
3-[2-(4-cyanophenyl)sulfonylethylamino]-2,2-dimethylpropanamide (PubChem CID 106275947) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is 3-[2-(4-cyanophenyl)sulfonylethylamino]-2,2-dimethylpropanamide.
| Compound Name | 3-[2-(4-cyanophenyl)sulfonylethylamino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 106275947 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 3-[2-(4-cyanophenyl)sulfonylethylamino]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CNCCS(=O)(=O)c1ccc(C#N)cc1)C(N)=O |
| InChI | InChI=1S/C14H19N3O3S/c1-14(2,13(16)18)10-17-7-8-21(19,20)12-5-3-11(9-15)4-6-12/h3-6,17H,7-8,10H2,1-2H3,(H2,16,18) |
| InChIKey | IZMMLXVGYZADQL-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|