C14H15N5 — CID 102806058
N-(1,3-dimethylpyrazol-4-yl)-3-methylquinoxalin-2-amine (PubChem CID 102806058) has the molecular formula C14H15N5 and a molecular weight of 253.31 g/mol. Its IUPAC name is N-(1,3-dimethylpyrazol-4-yl)-3-methylquinoxalin-2-amine.
| Compound Name | N-(1,3-dimethylpyrazol-4-yl)-3-methylquinoxalin-2-amine |
|---|---|
| PubChem CID | 102806058 |
| Molecular Formula | C14H15N5 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N-(1,3-dimethylpyrazol-4-yl)-3-methylquinoxalin-2-amine |
| SMILES | Cc1nn(C)cc1Nc1nc2ccccc2nc1C |
| InChI | InChI=1S/C14H15N5/c1-9-13(8-19(3)18-9)17-14-10(2)15-11-6-4-5-7-12(11)16-14/h4-8H,1-3H3,(H,16,17) |
| InChIKey | ORUDZNKYJISASU-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |