C10H13N5O — CID 102806174
N-(1,3-dimethylpyrazol-4-yl)-5-methoxypyrimidin-2-amine (PubChem CID 102806174) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is N-(1,3-dimethylpyrazol-4-yl)-5-methoxypyrimidin-2-amine.
| Compound Name | N-(1,3-dimethylpyrazol-4-yl)-5-methoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 102806174 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | N-(1,3-dimethylpyrazol-4-yl)-5-methoxypyrimidin-2-amine |
| SMILES | COc1cnc(Nc2cn(C)nc2C)nc1 |
| InChI | InChI=1S/C10H13N5O/c1-7-9(6-15(2)14-7)13-10-11-4-8(16-3)5-12-10/h4-6H,1-3H3,(H,11,12,13) |
| InChIKey | DFEPZPTZPWNTOG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |