About N-(1,3-dimethylpyrazol-4-yl)-5-methoxypyrimidin-2-amine
N-(1,3-dimethylpyrazol-4-yl)-5-methoxypyrimidin-2-amine (PubChem CID 102806174) has the molecular formula C10H13N5O
and a molecular weight of 219.25 g/mol. Its IUPAC name is N-(1,3-dimethylpyrazol-4-yl)-5-methoxypyrimidin-2-amine.
Molecular Properties
| Compound Name | N-(1,3-dimethylpyrazol-4-yl)-5-methoxypyrimidin-2-amine |
| PubChem CID | 102806174 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | N-(1,3-dimethylpyrazol-4-yl)-5-methoxypyrimidin-2-amine |
| SMILES | COc1cnc(Nc2cn(C)nc2C)nc1 |
| InChI | InChI=1S/C10H13N5O/c1-7-9(6-15(2)14-7)13-10-11-4-8(16-3)5-12-10/h4-6H,1-3H3,(H,11,12,13) |
| InChIKey | DFEPZPTZPWNTOG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(1,3-dimethylpyrazol-4-yl)-5-methoxypyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-dimethylpyrazol-4-yl)-5-methoxypyrimidin-2-amine?
The IUPAC name of N-(1,3-dimethylpyrazol-4-yl)-5-methoxypyrimidin-2-amine (CID 102806174) is N-(1,3-dimethylpyrazol-4-yl)-5-methoxypyrimidin-2-amine.
What is the SMILES notation for N-(1,3-dimethylpyrazol-4-yl)-5-methoxypyrimidin-2-amine?
The canonical SMILES for N-(1,3-dimethylpyrazol-4-yl)-5-methoxypyrimidin-2-amine is COc1cnc(Nc2cn(C)nc2C)nc1.
What is the InChIKey of N-(1,3-dimethylpyrazol-4-yl)-5-methoxypyrimidin-2-amine?
The InChIKey is DFEPZPTZPWNTOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5O/c1-7-9(6-15(2)14-7)13-10-11-4-8(16-3)5-12-10/h4-6H,1-3H3,(H,11,12,13).
What are the key properties of N-(1,3-dimethylpyrazol-4-yl)-5-methoxypyrimidin-2-amine?
N-(1,3-dimethylpyrazol-4-yl)-5-methoxypyrimidin-2-amine has a molecular weight of 219.25 g/mol, XLogP of 1.27, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-dimethylpyrazol-4-yl)-5-methoxypyrimidin-2-amine is sourced from PubChem (CID 102806174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).