C15H17ClN4O — CID 102806450
2-(1-chloroethyl)-1-(1,3-dimethylpyrazol-4-yl)-4-methoxybenzimidazole (PubChem CID 102806450) has the molecular formula C15H17ClN4O and a molecular weight of 304.78 g/mol. Its IUPAC name is 2-(1-chloroethyl)-1-(1,3-dimethylpyrazol-4-yl)-4-methoxybenzimidazole.
| Compound Name | 2-(1-chloroethyl)-1-(1,3-dimethylpyrazol-4-yl)-4-methoxybenzimidazole |
|---|---|
| PubChem CID | 102806450 |
| Molecular Formula | C15H17ClN4O |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2-(1-chloroethyl)-1-(1,3-dimethylpyrazol-4-yl)-4-methoxybenzimidazole |
| SMILES | COc1cccc2c1nc(C(C)Cl)n2-c1cn(C)nc1C |
| InChI | InChI=1S/C15H17ClN4O/c1-9(16)15-17-14-11(6-5-7-13(14)21-4)20(15)12-8-19(3)18-10(12)2/h5-9H,1-4H3 |
| InChIKey | DNCJFBLPQUXDSD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|