C15H10Cl2F2N2 — CID 104837748
4-chloro-2-(1-chloroethyl)-1-(2,3-difluorophenyl)benzimidazole (PubChem CID 104837748) has the molecular formula C15H10Cl2F2N2 and a molecular weight of 327.16 g/mol. Its IUPAC name is 4-chloro-2-(1-chloroethyl)-1-(2,3-difluorophenyl)benzimidazole.
| Compound Name | 4-chloro-2-(1-chloroethyl)-1-(2,3-difluorophenyl)benzimidazole |
|---|---|
| PubChem CID | 104837748 |
| Molecular Formula | C15H10Cl2F2N2 |
| Molecular Weight | 327.16 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 4-chloro-2-(1-chloroethyl)-1-(2,3-difluorophenyl)benzimidazole |
| SMILES | CC(Cl)c1nc2c(Cl)cccc2n1-c1cccc(F)c1F |
| InChI | InChI=1S/C15H10Cl2F2N2/c1-8(16)15-20-14-9(17)4-2-7-12(14)21(15)11-6-3-5-10(18)13(11)19/h2-8H,1H3 |
| InChIKey | SUVGOQVWNWYOSN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.16 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|