C15H11ClF2N2 — CID 61075050
2-(1-chloroethyl)-1-(2,3-difluorophenyl)benzimidazole (PubChem CID 61075050) has the molecular formula C15H11ClF2N2 and a molecular weight of 292.72 g/mol. Its IUPAC name is 2-(1-chloroethyl)-1-(2,3-difluorophenyl)benzimidazole.
| Compound Name | 2-(1-chloroethyl)-1-(2,3-difluorophenyl)benzimidazole |
|---|---|
| PubChem CID | 61075050 |
| Molecular Formula | C15H11ClF2N2 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-(1-chloroethyl)-1-(2,3-difluorophenyl)benzimidazole |
| SMILES | CC(Cl)c1nc2ccccc2n1-c1cccc(F)c1F |
| InChI | InChI=1S/C15H11ClF2N2/c1-9(16)15-19-11-6-2-3-7-12(11)20(15)13-8-4-5-10(17)14(13)18/h2-9H,1H3 |
| InChIKey | BKZUBHAJRRISDC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|