C13H15BrINO2 — CID 102808059
2-bromo-N-[(3-hydroxycyclobutyl)methyl]-5-iodo-N-methylbenzamide (PubChem CID 102808059) has the molecular formula C13H15BrINO2 and a molecular weight of 424.08 g/mol. Its IUPAC name is 2-bromo-N-[(3-hydroxycyclobutyl)methyl]-5-iodo-N-methylbenzamide.
| Compound Name | 2-bromo-N-[(3-hydroxycyclobutyl)methyl]-5-iodo-N-methylbenzamide |
|---|---|
| PubChem CID | 102808059 |
| Molecular Formula | C13H15BrINO2 |
| Molecular Weight | 424.08 g/mol |
| Exact Mass | 422.93 |
| IUPAC Name | 2-bromo-N-[(3-hydroxycyclobutyl)methyl]-5-iodo-N-methylbenzamide |
| SMILES | CN(CC1CC(O)C1)C(=O)c1cc(I)ccc1Br |
| InChI | InChI=1S/C13H15BrINO2/c1-16(7-8-4-10(17)5-8)13(18)11-6-9(15)2-3-12(11)14/h2-3,6,8,10,17H,4-5,7H2,1H3 |
| InChIKey | IFHYUMMNHMHNIT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.08 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|