C9H16N4O2 — CID 102808371
methyl 5-amino-3-(diethylamino)-1H-pyrazole-4-carboxylate (PubChem CID 102808371) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is methyl 5-amino-3-(diethylamino)-1H-pyrazole-4-carboxylate.
| Compound Name | methyl 5-amino-3-(diethylamino)-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 102808371 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | methyl 5-amino-3-(diethylamino)-1H-pyrazole-4-carboxylate |
| SMILES | CCN(CC)c1n[nH]c(N)c1C(=O)OC |
| InChI | InChI=1S/C9H16N4O2/c1-4-13(5-2)8-6(9(14)15-3)7(10)11-12-8/h4-5H2,1-3H3,(H3,10,11,12) |
| InChIKey | WXXSOBYBJSKKFA-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |