C13H24N4O2 — CID 102808860
methyl 5-amino-3-[ethyl(methyl)amino]-1-pentan-3-ylpyrazole-4-carboxylate (PubChem CID 102808860) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is methyl 5-amino-3-[ethyl(methyl)amino]-1-pentan-3-ylpyrazole-4-carboxylate.
| Compound Name | methyl 5-amino-3-[ethyl(methyl)amino]-1-pentan-3-ylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 102808860 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | methyl 5-amino-3-[ethyl(methyl)amino]-1-pentan-3-ylpyrazole-4-carboxylate |
| SMILES | CCC(CC)n1nc(N(C)CC)c(C(=O)OC)c1N |
| InChI | InChI=1S/C13H24N4O2/c1-6-9(7-2)17-11(14)10(13(18)19-5)12(15-17)16(4)8-3/h9H,6-8,14H2,1-5H3 |
| InChIKey | OHCKAODYEBHONP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |