C12H16N6O2 — CID 103294179
methyl 5-amino-3-[ethyl(methyl)amino]-1-pyridazin-3-ylpyrazole-4-carboxylate (PubChem CID 103294179) has the molecular formula C12H16N6O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is methyl 5-amino-3-[ethyl(methyl)amino]-1-pyridazin-3-ylpyrazole-4-carboxylate.
| Compound Name | methyl 5-amino-3-[ethyl(methyl)amino]-1-pyridazin-3-ylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 103294179 |
| Molecular Formula | C12H16N6O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | methyl 5-amino-3-[ethyl(methyl)amino]-1-pyridazin-3-ylpyrazole-4-carboxylate |
| SMILES | CCN(C)c1nn(-c2cccnn2)c(N)c1C(=O)OC |
| InChI | InChI=1S/C12H16N6O2/c1-4-17(2)11-9(12(19)20-3)10(13)18(16-11)8-6-5-7-14-15-8/h5-7H,4,13H2,1-3H3 |
| InChIKey | NTBNJNAKGWETOV-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |