C12H18N4O3 — CID 102808503
methyl 3-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-5-amino-1,2-oxazole-4-carboxylate (PubChem CID 102808503) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is methyl 3-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-5-amino-1,2-oxazole-4-carboxylate.
| Compound Name | methyl 3-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-5-amino-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 102808503 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | methyl 3-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-5-amino-1,2-oxazole-4-carboxylate |
| SMILES | COC(=O)c1c(N2CC3CCCNC3C2)noc1N |
| InChI | InChI=1S/C12H18N4O3/c1-18-12(17)9-10(13)19-15-11(9)16-5-7-3-2-4-14-8(7)6-16/h7-8,14H,2-6,13H2,1H3 |
| InChIKey | LZTQUNMINOJCPS-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |