C15H21N3O2 — CID 102683581
ethyl 6-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)pyridine-3-carboxylate (PubChem CID 102683581) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is ethyl 6-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)pyridine-3-carboxylate.
| Compound Name | ethyl 6-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 102683581 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | ethyl 6-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(N2CC3CCCNC3C2)nc1 |
| InChI | InChI=1S/C15H21N3O2/c1-2-20-15(19)11-5-6-14(17-8-11)18-9-12-4-3-7-16-13(12)10-18/h5-6,8,12-13,16H,2-4,7,9-10H2,1H3 |
| InChIKey | JEIXAQJWTBFNGA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |