C13H22N4O2 — CID 102809610
2,3-dimethyl-N-(4-methylcycloheptyl)-5-nitroimidazol-4-amine (PubChem CID 102809610) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2,3-dimethyl-N-(4-methylcycloheptyl)-5-nitroimidazol-4-amine.
| Compound Name | 2,3-dimethyl-N-(4-methylcycloheptyl)-5-nitroimidazol-4-amine |
|---|---|
| PubChem CID | 102809610 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 2,3-dimethyl-N-(4-methylcycloheptyl)-5-nitroimidazol-4-amine |
| SMILES | Cc1nc([N+](=O)[O-])c(NC2CCCC(C)CC2)n1C |
| InChI | InChI=1S/C13H22N4O2/c1-9-5-4-6-11(8-7-9)15-12-13(17(18)19)14-10(2)16(12)3/h9,11,15H,4-8H2,1-3H3 |
| InChIKey | UZRVXHAEEINCST-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|