C12H21N5O2 — CID 103555044
4-N-(2,3-dimethyl-5-nitroimidazol-4-yl)-1-N-methylcyclohexane-1,4-diamine (PubChem CID 103555044) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-N-(2,3-dimethyl-5-nitroimidazol-4-yl)-1-N-methylcyclohexane-1,4-diamine.
| Compound Name | 4-N-(2,3-dimethyl-5-nitroimidazol-4-yl)-1-N-methylcyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 103555044 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 4-N-(2,3-dimethyl-5-nitroimidazol-4-yl)-1-N-methylcyclohexane-1,4-diamine |
| SMILES | CNC1CCC(Nc2c([N+](=O)[O-])nc(C)n2C)CC1 |
| InChI | InChI=1S/C12H21N5O2/c1-8-14-12(17(18)19)11(16(8)3)15-10-6-4-9(13-2)5-7-10/h9-10,13,15H,4-7H2,1-3H3 |
| InChIKey | FODPYYHRWCREFZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|