C15H15BrClNO — CID 102814623
[3-bromo-5-(4-chloro-3,5-dimethylphenoxy)phenyl]methanamine (PubChem CID 102814623) has the molecular formula C15H15BrClNO and a molecular weight of 340.65 g/mol. Its IUPAC name is [3-bromo-5-(4-chloro-3,5-dimethylphenoxy)phenyl]methanamine.
| Compound Name | [3-bromo-5-(4-chloro-3,5-dimethylphenoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 102814623 |
| Molecular Formula | C15H15BrClNO |
| Molecular Weight | 340.65 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | [3-bromo-5-(4-chloro-3,5-dimethylphenoxy)phenyl]methanamine |
| SMILES | Cc1cc(Oc2cc(Br)cc(CN)c2)cc(C)c1Cl |
| InChI | InChI=1S/C15H15BrClNO/c1-9-3-13(4-10(2)15(9)17)19-14-6-11(8-18)5-12(16)7-14/h3-7H,8,18H2,1-2H3 |
| InChIKey | QDZDSPCXHYUPFV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.65 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |