C34H36F3N3O3 — CID 10281984
1-benzoyl-N-[5-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]pentyl]piperidine-4-carboxamide (PubChem CID 10281984) has the molecular formula C34H36F3N3O3 and a molecular weight of 591.67 g/mol. Its IUPAC name is 1-benzoyl-N-[5-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]pentyl]piperidine-4-carboxamide.
| Compound Name | 1-benzoyl-N-[5-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]pentyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 10281984 |
| Molecular Formula | C34H36F3N3O3 |
| Molecular Weight | 591.67 g/mol |
| Exact Mass | 591.27 |
| IUPAC Name | 1-benzoyl-N-[5-[9-(2,2,2-trifluoroethylcarbamoyl)fluoren-9-yl]pentyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCCCCC1(C(=O)NCC(F)(F)F)c2ccccc2-c2ccccc21)C1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C34H36F3N3O3/c35-34(36,37)23-39-32(43)33(28-15-7-5-13-26(28)27-14-6-8-16-29(27)33)19-9-2-10-20-38-30(41)24-17-21-40(22-18-24)31(42)25-11-3-1-4-12-25/h1,3-8,11-16,24H,2,9-10,17-23H2,(H,38,41)(H,39,43) |
| InChIKey | MDVPLCWTFHELDA-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.67 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|