C10H15NOS — CID 102820124
(2S)-2-(thiophen-2-ylmethoxymethyl)pyrrolidine (PubChem CID 102820124) has the molecular formula C10H15NOS and a molecular weight of 197.30 g/mol. Its IUPAC name is (2S)-2-(thiophen-2-ylmethoxymethyl)pyrrolidine.
| Compound Name | (2S)-2-(thiophen-2-ylmethoxymethyl)pyrrolidine |
|---|---|
| PubChem CID | 102820124 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | (2S)-2-(thiophen-2-ylmethoxymethyl)pyrrolidine |
| SMILES | c1csc(COC[C@@H]2CCCN2)c1 |
| InChI | InChI=1S/C10H15NOS/c1-3-9(11-5-1)7-12-8-10-4-2-6-13-10/h2,4,6,9,11H,1,3,5,7-8H2/t9-/m0/s1 |
| InChIKey | JSNHJDYZALVXEP-VIFPVBQESA-N |
| XLogP | 2.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |