C11H17ClN2O — CID 71637002
4-(pyrrolidin-2-ylmethoxymethyl)pyridine;hydrochloride (PubChem CID 71637002) has the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. Its IUPAC name is 4-(pyrrolidin-2-ylmethoxymethyl)pyridine;hydrochloride.
| Compound Name | 4-(pyrrolidin-2-ylmethoxymethyl)pyridine;hydrochloride |
|---|---|
| PubChem CID | 71637002 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 4-(pyrrolidin-2-ylmethoxymethyl)pyridine;hydrochloride |
| SMILES | Cl.c1cc(COCC2CCCN2)ccn1 |
| InChI | InChI=1S/C11H16N2O.ClH/c1-2-11(13-5-1)9-14-8-10-3-6-12-7-4-10;/h3-4,6-7,11,13H,1-2,5,8-9H2;1H |
| InChIKey | WJJGODZLZUSULS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |