C13H19NO2 — CID 102820162
(2R)-2-[[3-(methoxymethyl)phenoxy]methyl]pyrrolidine (PubChem CID 102820162) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (2R)-2-[[3-(methoxymethyl)phenoxy]methyl]pyrrolidine.
| Compound Name | (2R)-2-[[3-(methoxymethyl)phenoxy]methyl]pyrrolidine |
|---|---|
| PubChem CID | 102820162 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (2R)-2-[[3-(methoxymethyl)phenoxy]methyl]pyrrolidine |
| SMILES | COCc1cccc(OC[C@H]2CCCN2)c1 |
| InChI | InChI=1S/C13H19NO2/c1-15-9-11-4-2-6-13(8-11)16-10-12-5-3-7-14-12/h2,4,6,8,12,14H,3,5,7,9-10H2,1H3/t12-/m1/s1 |
| InChIKey | STBCRUDHACGIBM-GFCCVEGCSA-N |
| XLogP | 1.96 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |