C13H10N4O4 — CID 102821025
N-[4-(3-hydroxyprop-1-ynyl)-2-pyridinyl]-5-nitro-1H-pyrrole-2-carboxamide (PubChem CID 102821025) has the molecular formula C13H10N4O4 and a molecular weight of 286.25 g/mol. Its IUPAC name is N-[4-(3-hydroxyprop-1-ynyl)-2-pyridinyl]-5-nitro-1H-pyrrole-2-carboxamide.
| Compound Name | N-[4-(3-hydroxyprop-1-ynyl)-2-pyridinyl]-5-nitro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 102821025 |
| Molecular Formula | C13H10N4O4 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | N-[4-(3-hydroxyprop-1-ynyl)-2-pyridinyl]-5-nitro-1H-pyrrole-2-carboxamide |
| SMILES | O=C(Nc1cc(C#CCO)ccn1)c1ccc([N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C13H10N4O4/c18-7-1-2-9-5-6-14-11(8-9)16-13(19)10-3-4-12(15-10)17(20)21/h3-6,8,15,18H,7H2,(H,14,16,19) |
| InChIKey | QRQFCBDHJPDTBQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|