C13H10N4O4 — CID 102821067
N-[4-(3-hydroxyprop-1-ynyl)-2-pyridinyl]-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 102821067) has the molecular formula C13H10N4O4 and a molecular weight of 286.25 g/mol. Its IUPAC name is N-[4-(3-hydroxyprop-1-ynyl)-2-pyridinyl]-2,4-dioxo-1H-pyrimidine-6-carboxamide.
| Compound Name | N-[4-(3-hydroxyprop-1-ynyl)-2-pyridinyl]-2,4-dioxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 102821067 |
| Molecular Formula | C13H10N4O4 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | N-[4-(3-hydroxyprop-1-ynyl)-2-pyridinyl]-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | O=C(Nc1cc(C#CCO)ccn1)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C13H10N4O4/c18-5-1-2-8-3-4-14-10(6-8)16-12(20)9-7-11(19)17-13(21)15-9/h3-4,6-7,18H,5H2,(H,14,16,20)(H2,15,17,19,21) |
| InChIKey | YZIUHUHSGRMYOW-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 127.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|