C16H20N2O2S — CID 102821142
N-[4-(4-hydroxybut-1-ynyl)-2-pyridinyl]-2-(thian-4-yl)acetamide (PubChem CID 102821142) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is N-[4-(4-hydroxybut-1-ynyl)-2-pyridinyl]-2-(thian-4-yl)acetamide.
| Compound Name | N-[4-(4-hydroxybut-1-ynyl)-2-pyridinyl]-2-(thian-4-yl)acetamide |
|---|---|
| PubChem CID | 102821142 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-[4-(4-hydroxybut-1-ynyl)-2-pyridinyl]-2-(thian-4-yl)acetamide |
| SMILES | O=C(CC1CCSCC1)Nc1cc(C#CCCO)ccn1 |
| InChI | InChI=1S/C16H20N2O2S/c19-8-2-1-3-13-4-7-17-15(11-13)18-16(20)12-14-5-9-21-10-6-14/h4,7,11,14,19H,2,5-6,8-10,12H2,(H,17,18,20) |
| InChIKey | VIVAQPYJWPGOKQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|