C15H18N2O2 — CID 102821245
N-[4-(4-hydroxybut-1-ynyl)-2-pyridinyl]cyclopentanecarboxamide (PubChem CID 102821245) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is N-[4-(4-hydroxybut-1-ynyl)-2-pyridinyl]cyclopentanecarboxamide.
| Compound Name | N-[4-(4-hydroxybut-1-ynyl)-2-pyridinyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 102821245 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | N-[4-(4-hydroxybut-1-ynyl)-2-pyridinyl]cyclopentanecarboxamide |
| SMILES | O=C(Nc1cc(C#CCCO)ccn1)C1CCCC1 |
| InChI | InChI=1S/C15H18N2O2/c18-10-4-3-5-12-8-9-16-14(11-12)17-15(19)13-6-1-2-7-13/h8-9,11,13,18H,1-2,4,6-7,10H2,(H,16,17,19) |
| InChIKey | BEJCEBKXHCMOLB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|