C14H18N2O4 — CID 102822032
(E)-3-[2-[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]-4-pyridinyl]prop-2-enoic acid (PubChem CID 102822032) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is (E)-3-[2-[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]-4-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]-4-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102822032 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (E)-3-[2-[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]-4-pyridinyl]prop-2-enoic acid |
| SMILES | CC(C)(C)OCC(=O)Nc1cc(/C=C/C(=O)O)ccn1 |
| InChI | InChI=1S/C14H18N2O4/c1-14(2,3)20-9-12(17)16-11-8-10(6-7-15-11)4-5-13(18)19/h4-8H,9H2,1-3H3,(H,18,19)(H,15,16,17)/b5-4+ |
| InChIKey | ZTYVXGOKKYVJMG-SNAWJCMRSA-N |
| XLogP | 1.93 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|