C14H20N2O4S — CID 103521689
(E)-3-[2-(3,3-dimethylbutylsulfonylamino)-4-pyridinyl]prop-2-enoic acid (PubChem CID 103521689) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is (E)-3-[2-(3,3-dimethylbutylsulfonylamino)-4-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(3,3-dimethylbutylsulfonylamino)-4-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103521689 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | (E)-3-[2-(3,3-dimethylbutylsulfonylamino)-4-pyridinyl]prop-2-enoic acid |
| SMILES | CC(C)(C)CCS(=O)(=O)Nc1cc(/C=C/C(=O)O)ccn1 |
| InChI | InChI=1S/C14H20N2O4S/c1-14(2,3)7-9-21(19,20)16-12-10-11(6-8-15-12)4-5-13(17)18/h4-6,8,10H,7,9H2,1-3H3,(H,15,16)(H,17,18)/b5-4+ |
| InChIKey | SSKNQDFGUWOODE-SNAWJCMRSA-N |
| XLogP | 2.36 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|