C10H11N3O6S — CID 102822187
(E)-3-[2-(methoxycarbonylsulfamoylamino)-4-pyridinyl]prop-2-enoic acid (PubChem CID 102822187) has the molecular formula C10H11N3O6S and a molecular weight of 301.28 g/mol. Its IUPAC name is (E)-3-[2-(methoxycarbonylsulfamoylamino)-4-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(methoxycarbonylsulfamoylamino)-4-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102822187 |
| Molecular Formula | C10H11N3O6S |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | (E)-3-[2-(methoxycarbonylsulfamoylamino)-4-pyridinyl]prop-2-enoic acid |
| SMILES | COC(=O)NS(=O)(=O)Nc1cc(/C=C/C(=O)O)ccn1 |
| InChI | InChI=1S/C10H11N3O6S/c1-19-10(16)13-20(17,18)12-8-6-7(4-5-11-8)2-3-9(14)15/h2-6H,1H3,(H,11,12)(H,13,16)(H,14,15)/b3-2+ |
| InChIKey | HCLJNVLKEYSORR-NSCUHMNNSA-N |
| XLogP | 0.19 |
| TPSA | 134.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|