C32H27Cl2NO7 — CID 10282363
2-[4-[bis[(6-chloro-4H-1,3-benzodioxin-5-yl)methyl]amino]phenoxy]-2-phenylacetic acid (PubChem CID 10282363) has the molecular formula C32H27Cl2NO7 and a molecular weight of 608.47 g/mol. Its IUPAC name is 2-[4-[bis[(6-chloro-4H-1,3-benzodioxin-5-yl)methyl]amino]phenoxy]-2-phenylacetic acid.
| Compound Name | 2-[4-[bis[(6-chloro-4H-1,3-benzodioxin-5-yl)methyl]amino]phenoxy]-2-phenylacetic acid |
|---|---|
| PubChem CID | 10282363 |
| Molecular Formula | C32H27Cl2NO7 |
| Molecular Weight | 608.47 g/mol |
| Exact Mass | 607.12 |
| IUPAC Name | 2-[4-[bis[(6-chloro-4H-1,3-benzodioxin-5-yl)methyl]amino]phenoxy]-2-phenylacetic acid |
| SMILES | O=C(O)C(Oc1ccc(N(Cc2c(Cl)ccc3c2COCO3)Cc2c(Cl)ccc3c2COCO3)cc1)c1ccccc1 |
| InChI | InChI=1S/C32H27Cl2NO7/c33-27-10-12-29-25(16-38-18-40-29)23(27)14-35(15-24-26-17-39-19-41-30(26)13-11-28(24)34)21-6-8-22(9-7-21)42-31(32(36)37)20-4-2-1-3-5-20/h1-13,31H,14-19H2,(H,36,37) |
| InChIKey | QVRNYOQFHBCECE-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.47 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|