C14H10Cl2O3 — CID 42177498
(2R)-2-(2,5-dichlorophenoxy)-2-phenylacetic acid (PubChem CID 42177498) has the molecular formula C14H10Cl2O3 and a molecular weight of 297.14 g/mol. Its IUPAC name is (2R)-2-(2,5-dichlorophenoxy)-2-phenylacetic acid.
| Compound Name | (2R)-2-(2,5-dichlorophenoxy)-2-phenylacetic acid |
|---|---|
| PubChem CID | 42177498 |
| Molecular Formula | C14H10Cl2O3 |
| Molecular Weight | 297.14 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | (2R)-2-(2,5-dichlorophenoxy)-2-phenylacetic acid |
| SMILES | O=C(O)[C@H](Oc1cc(Cl)ccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C14H10Cl2O3/c15-10-6-7-11(16)12(8-10)19-13(14(17)18)9-4-2-1-3-5-9/h1-8,13H,(H,17,18)/t13-/m1/s1 |
| InChIKey | KPQSCXHTLWZXOP-CYBMUJFWSA-N |
| XLogP | 4.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.14 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |