C20H17ClN3O3- — CID 142810971
[(Z)-(6-aminocyclohexa-2,4-dien-1-ylidene)amino]-[2-[carboxy(phenyl)methoxy]-5-chlorophenyl]azanide (PubChem CID 142810971) has the molecular formula C20H17ClN3O3- and a molecular weight of 382.83 g/mol. Its IUPAC name is [(Z)-(6-aminocyclohexa-2,4-dien-1-ylidene)amino]-[2-[carboxy(phenyl)methoxy]-5-chlorophenyl]azanide.
| Compound Name | [(Z)-(6-aminocyclohexa-2,4-dien-1-ylidene)amino]-[2-[carboxy(phenyl)methoxy]-5-chlorophenyl]azanide |
|---|---|
| PubChem CID | 142810971 |
| Molecular Formula | C20H17ClN3O3- |
| Molecular Weight | 382.83 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | [(Z)-(6-aminocyclohexa-2,4-dien-1-ylidene)amino]-[2-[carboxy(phenyl)methoxy]-5-chlorophenyl]azanide |
| SMILES | NC1C=CC=C/C1=N/[N-]c1cc(Cl)ccc1OC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C20H17ClN3O3/c21-14-10-11-18(27-19(20(25)26)13-6-2-1-3-7-13)17(12-14)24-23-16-9-5-4-8-15(16)22/h1-12,15,19H,22H2,(H,25,26)/q-1/b23-16- |
| InChIKey | SAXSKTGBTVCSBA-KQWNVCNZSA-N |
| XLogP | 4.36 |
| TPSA | 99.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.83 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|