About 3-N,3-N-dimethyl-4-methylsulfonyl-1-pyrimidin-2-ylpyrazole-3,5-diamine
3-N,3-N-dimethyl-4-methylsulfonyl-1-pyrimidin-2-ylpyrazole-3,5-diamine (PubChem CID 102825799) has the molecular formula C10H14N6O2S
and a molecular weight of 282.33 g/mol. Its IUPAC name is 3-N,3-N-dimethyl-4-methylsulfonyl-1-pyrimidin-2-ylpyrazole-3,5-diamine.
Molecular Properties
| Compound Name | 3-N,3-N-dimethyl-4-methylsulfonyl-1-pyrimidin-2-ylpyrazole-3,5-diamine |
| PubChem CID | 102825799 |
| Molecular Formula | C10H14N6O2S |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 3-N,3-N-dimethyl-4-methylsulfonyl-1-pyrimidin-2-ylpyrazole-3,5-diamine |
| SMILES | CN(C)c1nn(-c2ncccn2)c(N)c1S(C)(=O)=O |
| InChI | InChI=1S/C10H14N6O2S/c1-15(2)9-7(19(3,17)18)8(11)16(14-9)10-12-5-4-6-13-10/h4-6H,11H2,1-3H3 |
| InChIKey | MMQPNJMQKMPLOW-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-N,3-N-dimethyl-4-methylsulfonyl-1-pyrimidin-2-ylpyrazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N,3-N-dimethyl-4-methylsulfonyl-1-pyrimidin-2-ylpyrazole-3,5-diamine?
The IUPAC name of 3-N,3-N-dimethyl-4-methylsulfonyl-1-pyrimidin-2-ylpyrazole-3,5-diamine (CID 102825799) is 3-N,3-N-dimethyl-4-methylsulfonyl-1-pyrimidin-2-ylpyrazole-3,5-diamine.
What is the SMILES notation for 3-N,3-N-dimethyl-4-methylsulfonyl-1-pyrimidin-2-ylpyrazole-3,5-diamine?
The canonical SMILES for 3-N,3-N-dimethyl-4-methylsulfonyl-1-pyrimidin-2-ylpyrazole-3,5-diamine is CN(C)c1nn(-c2ncccn2)c(N)c1S(C)(=O)=O.
What is the InChIKey of 3-N,3-N-dimethyl-4-methylsulfonyl-1-pyrimidin-2-ylpyrazole-3,5-diamine?
The InChIKey is MMQPNJMQKMPLOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N6O2S/c1-15(2)9-7(19(3,17)18)8(11)16(14-9)10-12-5-4-6-13-10/h4-6H,11H2,1-3H3.
What are the key properties of 3-N,3-N-dimethyl-4-methylsulfonyl-1-pyrimidin-2-ylpyrazole-3,5-diamine?
3-N,3-N-dimethyl-4-methylsulfonyl-1-pyrimidin-2-ylpyrazole-3,5-diamine has a molecular weight of 282.33 g/mol, XLogP of -0.29, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N,3-N-dimethyl-4-methylsulfonyl-1-pyrimidin-2-ylpyrazole-3,5-diamine is sourced from PubChem (CID 102825799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).