C15H24BrNS — CID 102827500
1-(4-bromo-5-methylthiophen-2-yl)-3-cyclopentyl-N-ethylpropan-1-amine (PubChem CID 102827500) has the molecular formula C15H24BrNS and a molecular weight of 330.34 g/mol. Its IUPAC name is 1-(4-bromo-5-methylthiophen-2-yl)-3-cyclopentyl-N-ethylpropan-1-amine.
| Compound Name | 1-(4-bromo-5-methylthiophen-2-yl)-3-cyclopentyl-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 102827500 |
| Molecular Formula | C15H24BrNS |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 1-(4-bromo-5-methylthiophen-2-yl)-3-cyclopentyl-N-ethylpropan-1-amine |
| SMILES | CCNC(CCC1CCCC1)c1cc(Br)c(C)s1 |
| InChI | InChI=1S/C15H24BrNS/c1-3-17-14(9-8-12-6-4-5-7-12)15-10-13(16)11(2)18-15/h10,12,14,17H,3-9H2,1-2H3 |
| InChIKey | BPXTUPBJOWMXEJ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |