C18H29N — CID 115796908
3-cyclopentyl-1-(3,5-dimethylphenyl)-N-ethylpropan-1-amine (PubChem CID 115796908) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is 3-cyclopentyl-1-(3,5-dimethylphenyl)-N-ethylpropan-1-amine.
| Compound Name | 3-cyclopentyl-1-(3,5-dimethylphenyl)-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 115796908 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 3-cyclopentyl-1-(3,5-dimethylphenyl)-N-ethylpropan-1-amine |
| SMILES | CCNC(CCC1CCCC1)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C18H29N/c1-4-19-18(10-9-16-7-5-6-8-16)17-12-14(2)11-15(3)13-17/h11-13,16,18-19H,4-10H2,1-3H3 |
| InChIKey | MTNCLPNASMABFZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |