C13H7BrF2N2OS — CID 102829028
4-(4-bromo-5-methylthiophen-2-yl)-6,7-difluoro-2H-phthalazin-1-one (PubChem CID 102829028) has the molecular formula C13H7BrF2N2OS and a molecular weight of 357.18 g/mol. Its IUPAC name is 4-(4-bromo-5-methylthiophen-2-yl)-6,7-difluoro-2H-phthalazin-1-one.
| Compound Name | 4-(4-bromo-5-methylthiophen-2-yl)-6,7-difluoro-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 102829028 |
| Molecular Formula | C13H7BrF2N2OS |
| Molecular Weight | 357.18 g/mol |
| Exact Mass | 355.94 |
| IUPAC Name | 4-(4-bromo-5-methylthiophen-2-yl)-6,7-difluoro-2H-phthalazin-1-one |
| SMILES | Cc1sc(-c2n[nH]c(=O)c3cc(F)c(F)cc23)cc1Br |
| InChI | InChI=1S/C13H7BrF2N2OS/c1-5-8(14)4-11(20-5)12-6-2-9(15)10(16)3-7(6)13(19)18-17-12/h2-4H,1H3,(H,18,19) |
| InChIKey | SIOAPXUXVRTHEV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.18 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |