About 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-thiazole-5-carboxylic acid
2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 102842168) has the molecular formula C9H5Br2NO2S2
and a molecular weight of 383.09 g/mol. Its IUPAC name is 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 102842168 |
| Molecular Formula | C9H5Br2NO2S2 |
| Molecular Weight | 383.09 g/mol |
| Exact Mass | 380.81 |
| IUPAC Name | 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(-c2cc(Br)c(Br)s2)sc1C(=O)O |
| InChI | InChI=1S/C9H5Br2NO2S2/c1-3-6(9(13)14)16-8(12-3)5-2-4(10)7(11)15-5/h2H,1H3,(H,13,14) |
| InChIKey | URAQQGONTXUQOD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.09 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-thiazole-5-carboxylic acid (CID 102842168) is 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-thiazole-5-carboxylic acid is Cc1nc(-c2cc(Br)c(Br)s2)sc1C(=O)O.
What is the InChIKey of 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-thiazole-5-carboxylic acid?
The InChIKey is URAQQGONTXUQOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5Br2NO2S2/c1-3-6(9(13)14)16-8(12-3)5-2-4(10)7(11)15-5/h2H,1H3,(H,13,14).
What are the key properties of 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-thiazole-5-carboxylic acid?
2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-thiazole-5-carboxylic acid has a molecular weight of 383.09 g/mol, XLogP of 4.40, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dibromothiophen-2-yl)-4-methyl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 102842168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).