C10H8Br3N3S — CID 102843992
5-bromo-2-(4,5-dibromothiophen-2-yl)-6-ethylpyrimidin-4-amine (PubChem CID 102843992) has the molecular formula C10H8Br3N3S and a molecular weight of 441.97 g/mol. Its IUPAC name is 5-bromo-2-(4,5-dibromothiophen-2-yl)-6-ethylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-(4,5-dibromothiophen-2-yl)-6-ethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 102843992 |
| Molecular Formula | C10H8Br3N3S |
| Molecular Weight | 441.97 g/mol |
| Exact Mass | 438.80 |
| IUPAC Name | 5-bromo-2-(4,5-dibromothiophen-2-yl)-6-ethylpyrimidin-4-amine |
| SMILES | CCc1nc(-c2cc(Br)c(Br)s2)nc(N)c1Br |
| InChI | InChI=1S/C10H8Br3N3S/c1-2-5-7(12)9(14)16-10(15-5)6-3-4(11)8(13)17-6/h3H,2H2,1H3,(H2,14,15,16) |
| InChIKey | HEYJWWILNDALAK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.97 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |