C12H13Br2N3S — CID 102843839
6-tert-butyl-2-(4,5-dibromothiophen-2-yl)pyrimidin-4-amine (PubChem CID 102843839) has the molecular formula C12H13Br2N3S and a molecular weight of 391.13 g/mol. Its IUPAC name is 6-tert-butyl-2-(4,5-dibromothiophen-2-yl)pyrimidin-4-amine.
| Compound Name | 6-tert-butyl-2-(4,5-dibromothiophen-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 102843839 |
| Molecular Formula | C12H13Br2N3S |
| Molecular Weight | 391.13 g/mol |
| Exact Mass | 388.92 |
| IUPAC Name | 6-tert-butyl-2-(4,5-dibromothiophen-2-yl)pyrimidin-4-amine |
| SMILES | CC(C)(C)c1cc(N)nc(-c2cc(Br)c(Br)s2)n1 |
| InChI | InChI=1S/C12H13Br2N3S/c1-12(2,3)8-5-9(15)17-11(16-8)7-4-6(13)10(14)18-7/h4-5H,1-3H3,(H2,15,16,17) |
| InChIKey | IKUOZTLUFCJGAK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.13 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |