C13H22N2 — CID 166788497
4,6-ditert-butylpyridin-2-amine (PubChem CID 166788497) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 4,6-ditert-butylpyridin-2-amine.
| Compound Name | 4,6-ditert-butylpyridin-2-amine |
|---|---|
| PubChem CID | 166788497 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 4,6-ditert-butylpyridin-2-amine |
| SMILES | CC(C)(C)c1cc(N)nc(C(C)(C)C)c1 |
| InChI | InChI=1S/C13H22N2/c1-12(2,3)9-7-10(13(4,5)6)15-11(14)8-9/h7-8H,1-6H3,(H2,14,15) |
| InChIKey | VGZWTINKVJABCL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |