C12H16N4S — CID 104771374
6-tert-butyl-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine (PubChem CID 104771374) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is 6-tert-butyl-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine.
| Compound Name | 6-tert-butyl-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 104771374 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 6-tert-butyl-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine |
| SMILES | Cc1csc(-c2nc(N)cc(C(C)(C)C)n2)n1 |
| InChI | InChI=1S/C12H16N4S/c1-7-6-17-11(14-7)10-15-8(12(2,3)4)5-9(13)16-10/h5-6H,1-4H3,(H2,13,15,16) |
| InChIKey | UVHDNOGOGYQEKN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |