C14H21BrN2OS — CID 102844603
N-[[3-(4-bromo-5-methylthiophen-2-yl)-4-methylmorpholin-2-yl]methyl]cyclopropanamine (PubChem CID 102844603) has the molecular formula C14H21BrN2OS and a molecular weight of 345.31 g/mol. Its IUPAC name is N-[[3-(4-bromo-5-methylthiophen-2-yl)-4-methylmorpholin-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[3-(4-bromo-5-methylthiophen-2-yl)-4-methylmorpholin-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 102844603 |
| Molecular Formula | C14H21BrN2OS |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | N-[[3-(4-bromo-5-methylthiophen-2-yl)-4-methylmorpholin-2-yl]methyl]cyclopropanamine |
| SMILES | Cc1sc(C2C(CNC3CC3)OCCN2C)cc1Br |
| InChI | InChI=1S/C14H21BrN2OS/c1-9-11(15)7-13(19-9)14-12(8-16-10-3-4-10)18-6-5-17(14)2/h7,10,12,14,16H,3-6,8H2,1-2H3 |
| InChIKey | BLDFPQCXHYXOAP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |