C15H22BrClN2O — CID 66159173
N-[[3-(2-bromo-5-chlorophenyl)-4-methylmorpholin-2-yl]methyl]propan-2-amine (PubChem CID 66159173) has the molecular formula C15H22BrClN2O and a molecular weight of 361.71 g/mol. Its IUPAC name is N-[[3-(2-bromo-5-chlorophenyl)-4-methylmorpholin-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[3-(2-bromo-5-chlorophenyl)-4-methylmorpholin-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 66159173 |
| Molecular Formula | C15H22BrClN2O |
| Molecular Weight | 361.71 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | N-[[3-(2-bromo-5-chlorophenyl)-4-methylmorpholin-2-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCC1OCCN(C)C1c1cc(Cl)ccc1Br |
| InChI | InChI=1S/C15H22BrClN2O/c1-10(2)18-9-14-15(19(3)6-7-20-14)12-8-11(17)4-5-13(12)16/h4-5,8,10,14-15,18H,6-7,9H2,1-3H3 |
| InChIKey | JHDVUMKAIKUYDT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.71 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |