C17H26BrClN2 — CID 66160939
1-[2-(2-bromo-5-chlorophenyl)-1-propylazepan-3-yl]-N-methylmethanamine (PubChem CID 66160939) has the molecular formula C17H26BrClN2 and a molecular weight of 373.77 g/mol. Its IUPAC name is 1-[2-(2-bromo-5-chlorophenyl)-1-propylazepan-3-yl]-N-methylmethanamine.
| Compound Name | 1-[2-(2-bromo-5-chlorophenyl)-1-propylazepan-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 66160939 |
| Molecular Formula | C17H26BrClN2 |
| Molecular Weight | 373.77 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 1-[2-(2-bromo-5-chlorophenyl)-1-propylazepan-3-yl]-N-methylmethanamine |
| SMILES | CCCN1CCCCC(CNC)C1c1cc(Cl)ccc1Br |
| InChI | InChI=1S/C17H26BrClN2/c1-3-9-21-10-5-4-6-13(12-20-2)17(21)15-11-14(19)7-8-16(15)18/h7-8,11,13,17,20H,3-6,9-10,12H2,1-2H3 |
| InChIKey | OADUGSWEGSEYRP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.77 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |