C15H22ClFN2O — CID 114866612
1-[3-(4-chloro-2-fluorophenyl)-4-propylmorpholin-2-yl]-N-methylmethanamine (PubChem CID 114866612) has the molecular formula C15H22ClFN2O and a molecular weight of 300.80 g/mol. Its IUPAC name is 1-[3-(4-chloro-2-fluorophenyl)-4-propylmorpholin-2-yl]-N-methylmethanamine.
| Compound Name | 1-[3-(4-chloro-2-fluorophenyl)-4-propylmorpholin-2-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 114866612 |
| Molecular Formula | C15H22ClFN2O |
| Molecular Weight | 300.80 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 1-[3-(4-chloro-2-fluorophenyl)-4-propylmorpholin-2-yl]-N-methylmethanamine |
| SMILES | CCCN1CCOC(CNC)C1c1ccc(Cl)cc1F |
| InChI | InChI=1S/C15H22ClFN2O/c1-3-6-19-7-8-20-14(10-18-2)15(19)12-5-4-11(16)9-13(12)17/h4-5,9,14-15,18H,3,6-8,10H2,1-2H3 |
| InChIKey | IWFICWPTWLERFS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.80 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |