C15H22ClFN2 — CID 114454759
1-[2-(3-chloro-5-fluorophenyl)-1-propylpyrrolidin-3-yl]-N-methylmethanamine (PubChem CID 114454759) has the molecular formula C15H22ClFN2 and a molecular weight of 284.81 g/mol. Its IUPAC name is 1-[2-(3-chloro-5-fluorophenyl)-1-propylpyrrolidin-3-yl]-N-methylmethanamine.
| Compound Name | 1-[2-(3-chloro-5-fluorophenyl)-1-propylpyrrolidin-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 114454759 |
| Molecular Formula | C15H22ClFN2 |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-[2-(3-chloro-5-fluorophenyl)-1-propylpyrrolidin-3-yl]-N-methylmethanamine |
| SMILES | CCCN1CCC(CNC)C1c1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C15H22ClFN2/c1-3-5-19-6-4-11(10-18-2)15(19)12-7-13(16)9-14(17)8-12/h7-9,11,15,18H,3-6,10H2,1-2H3 |
| InChIKey | RVBWTYMHZUKXEF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |